Дифенилоксазол-2,5

Дифенилоксазол-2,5

Дифенилоксазол-2,5
Цена за кг/л с учетом НДС:  12,000,00 руб. – заказать
Фасовка: 1 кг
Квал.: ч
Дифенилоксазол-2,5, рро; 2,5-дифенилоксазол, сцинтилляционный

Систематическое наименование: Дифенилоксазол-2,5
Сокращение: рро
Традиционное название: Дифенилоксазол-2,5
Химическая формула: C15H11NO
Состояние: жидкое
Молярная масса: 221.26
Плотность:
Рег. номер CAS 92-71-7
PubChem
Рег. номер EINECS 202-181-3
SMILES C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3
RTECS
ChemSpider